C11H14N2O — CID 142086971
5-methyl-1-[(1E)-1-(methylamino)buta-1,3-dienyl]pyridin-2-one (PubChem CID 142086971) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-methyl-1-[(1E)-1-(methylamino)buta-1,3-dienyl]pyridin-2-one.
| Compound Name | 5-methyl-1-[(1E)-1-(methylamino)buta-1,3-dienyl]pyridin-2-one |
|---|---|
| PubChem CID | 142086971 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-methyl-1-[(1E)-1-(methylamino)buta-1,3-dienyl]pyridin-2-one |
| SMILES | C=C/C=C(\NC)n1cc(C)ccc1=O |
| InChI | InChI=1S/C11H14N2O/c1-4-5-10(12-3)13-8-9(2)6-7-11(13)14/h4-8,12H,1H2,2-3H3/b10-5+ |
| InChIKey | WGQBEYWATWHWND-BJMVGYQFSA-N |
| XLogP | 1.36 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|