About 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane
8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane (PubChem CID 142087296) has the molecular formula C19H36O3
and a molecular weight of 312.49 g/mol. Its IUPAC name is 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane |
| PubChem CID | 142087296 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane |
| SMILES | CCC(O)CCCCCC1CC=CC1.CCCC1OCCO1 |
| InChI | InChI=1S/C13H24O.C6H12O2/c1-2-13(14)11-5-3-4-8-12-9-6-7-10-12;1-2-3-6-7-4-5-8-6/h6-7,12-14H,2-5,8-11H2,1H3;6H,2-5H2,1H3 |
| InChIKey | NNKKDTXESVGVKD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane?
The IUPAC name of 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane (CID 142087296) is 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane.
What is the SMILES notation for 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane?
The canonical SMILES for 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane is CCC(O)CCCCCC1CC=CC1.CCCC1OCCO1.
What is the InChIKey of 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane?
The InChIKey is NNKKDTXESVGVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O.C6H12O2/c1-2-13(14)11-5-3-4-8-12-9-6-7-10-12;1-2-3-6-7-4-5-8-6/h6-7,12-14H,2-5,8-11H2,1H3;6H,2-5H2,1H3.
What are the key properties of 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane?
8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane has a molecular weight of 312.49 g/mol, XLogP of 4.83, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopent-3-en-1-yloctan-3-ol;2-propyl-1,3-dioxolane is sourced from PubChem (CID 142087296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).