About 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane
8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane (PubChem CID 142087327) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane.
Molecular Properties
| Compound Name | 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane |
| PubChem CID | 142087327 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane |
| SMILES | CC.CC(C)C1=CCC(C)(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C15H21N.C2H6/c1-10(2)12-7-8-15(3,4)14-9-11(16)5-6-13(12)14;1-2/h5-7,9-10H,8,16H2,1-4H3;1-2H3 |
| InChIKey | BPVZXAQUSZGIEM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane?
The IUPAC name of 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane (CID 142087327) is 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane.
What is the SMILES notation for 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane?
The canonical SMILES for 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane is CC.CC(C)C1=CCC(C)(C)c2cc(N)ccc21.
What is the InChIKey of 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane?
The InChIKey is BPVZXAQUSZGIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C2H6/c1-10(2)12-7-8-15(3,4)14-9-11(16)5-6-13(12)14;1-2/h5-7,9-10H,8,16H2,1-4H3;1-2H3.
What are the key properties of 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane?
8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane has a molecular weight of 245.41 g/mol, XLogP of 5.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-5-propan-2-yl-7H-naphthalen-2-amine;ethane is sourced from PubChem (CID 142087327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).