C6H11N3O2S — CID 142087630
1-(aminocarbamothioyl)pyrrolidine-2-carboxylic acid (PubChem CID 142087630) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is 1-(aminocarbamothioyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(aminocarbamothioyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142087630 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1-(aminocarbamothioyl)pyrrolidine-2-carboxylic acid |
| SMILES | NNC(=S)N1CCCC1C(=O)O |
| InChI | InChI=1S/C6H11N3O2S/c7-8-6(12)9-3-1-2-4(9)5(10)11/h4H,1-3,7H2,(H,8,12)(H,10,11) |
| InChIKey | ALKOSSPOUGMMOJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|