C15H16Cl2N4 — CID 142087647
2-(4-amino-2,6-dichlorophenyl)-2-(6-methylpyridazin-3-yl)acetonitrile;ethane (PubChem CID 142087647) has the molecular formula C15H16Cl2N4 and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-(4-amino-2,6-dichlorophenyl)-2-(6-methylpyridazin-3-yl)acetonitrile;ethane.
| Compound Name | 2-(4-amino-2,6-dichlorophenyl)-2-(6-methylpyridazin-3-yl)acetonitrile;ethane |
|---|---|
| PubChem CID | 142087647 |
| Molecular Formula | C15H16Cl2N4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(4-amino-2,6-dichlorophenyl)-2-(6-methylpyridazin-3-yl)acetonitrile;ethane |
| SMILES | CC.Cc1ccc(C(C#N)c2c(Cl)cc(N)cc2Cl)nn1 |
| InChI | InChI=1S/C13H10Cl2N4.C2H6/c1-7-2-3-12(19-18-7)9(6-16)13-10(14)4-8(17)5-11(13)15;1-2/h2-5,9H,17H2,1H3;1-2H3 |
| InChIKey | WQZSDQGJGUNGPA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|