C14H18N4O2S — CID 142087763
2-(3-ethanimidoylphenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)acetamide;methanol (PubChem CID 142087763) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-(3-ethanimidoylphenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)acetamide;methanol.
| Compound Name | 2-(3-ethanimidoylphenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)acetamide;methanol |
|---|---|
| PubChem CID | 142087763 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(3-ethanimidoylphenyl)-N-(3-methyl-1,2,4-thiadiazol-5-yl)acetamide;methanol |
| SMILES | CO.[H]/N=C(\C)c1cccc(CC(=O)Nc2nc(C)ns2)c1 |
| InChI | InChI=1S/C13H14N4OS.CH4O/c1-8(14)11-5-3-4-10(6-11)7-12(18)16-13-15-9(2)17-19-13;1-2/h3-6,14H,7H2,1-2H3,(H,15,16,17,18);2H,1H3/b14-8+; |
| InChIKey | ZZACYYKFCWYNSD-XHIXCECLSA-N |
| XLogP | 2.02 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|