C37H34N2 — CID 142088031
4-[4-[4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4-dien-2-yl]phenyl]phenyl]aniline (PubChem CID 142088031) has the molecular formula C37H34N2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 4-[4-[4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4-dien-2-yl]phenyl]phenyl]aniline.
| Compound Name | 4-[4-[4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4-dien-2-yl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 142088031 |
| Molecular Formula | C37H34N2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 4-[4-[4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4-dien-2-yl]phenyl]phenyl]aniline |
| SMILES | CC/C(=C\C=C(/C)c1ccc(-c2ccc(-c3ccc(N)cc3)cc2)cc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H34N2/c1-3-35(39(36-10-6-4-7-11-36)37-12-8-5-9-13-37)27-14-28(2)29-15-17-30(18-16-29)31-19-21-32(22-20-31)33-23-25-34(38)26-24-33/h4-27H,3,38H2,1-2H3/b28-14+,35-27+ |
| InChIKey | KCIOUXFPLIJHRY-DGTNFALHSA-N |
| XLogP | 10.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|