C60H52N6 — CID 142088052
4-[6-[9-[4-(dimethylamino)phenyl]-6-[9-[4-(dimethylamino)phenyl]carbazol-3-yl]carbazol-3-yl]-2,3-dihydrocarbazol-9-yl]-N,N-dimethylaniline (PubChem CID 142088052) has the molecular formula C60H52N6 and a molecular weight of 857.12 g/mol. Its IUPAC name is 4-[6-[9-[4-(dimethylamino)phenyl]-6-[9-[4-(dimethylamino)phenyl]carbazol-3-yl]carbazol-3-yl]-2,3-dihydrocarbazol-9-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-[9-[4-(dimethylamino)phenyl]-6-[9-[4-(dimethylamino)phenyl]carbazol-3-yl]carbazol-3-yl]-2,3-dihydrocarbazol-9-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142088052 |
| Molecular Formula | C60H52N6 |
| Molecular Weight | 857.12 g/mol |
| Exact Mass | 856.43 |
| IUPAC Name | 4-[6-[9-[4-(dimethylamino)phenyl]-6-[9-[4-(dimethylamino)phenyl]carbazol-3-yl]carbazol-3-yl]-2,3-dihydrocarbazol-9-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-n2c3c(c4cc(-c5ccc6c(c5)c5cc(-c7ccc8c(c7)c7ccccc7n8-c7ccc(N(C)C)cc7)ccc5n6-c5ccc(N(C)C)cc5)ccc42)=CCCC=3)cc1 |
| InChI | InChI=1S/C60H52N6/c1-61(2)43-19-25-46(26-20-43)64-55-13-9-7-11-49(55)51-35-39(15-31-57(51)64)41-17-33-59-53(37-41)54-38-42(18-34-60(54)66(59)48-29-23-45(24-30-48)63(5)6)40-16-32-58-52(36-40)50-12-8-10-14-56(50)65(58)47-27-21-44(22-28-47)62(3)4/h7,9,11-38H,8,10H2,1-6H3 |
| InChIKey | LZJZITATVGCCRK-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 24.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.12 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|