C15H23NO — CID 142088055
N-[4-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]cyclohexyl]formamide (PubChem CID 142088055) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]cyclohexyl]formamide.
| Compound Name | N-[4-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 142088055 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[4-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]cyclohexyl]formamide |
| SMILES | C=C/C(C)=C\C=C\CC1CCC(NC=O)CC1 |
| InChI | InChI=1S/C15H23NO/c1-3-13(2)6-4-5-7-14-8-10-15(11-9-14)16-12-17/h3-6,12,14-15H,1,7-11H2,2H3,(H,16,17)/b5-4+,13-6- |
| InChIKey | PAQJEGGURXQNFO-XFYQWYMDSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|