C32H31BrN2O5 — CID 142088150
ethyl (E)-3-[4-[5-(4-bromophenyl)-4-[4-(2-butoxy-2-oxoethoxy)phenyl]-1H-imidazol-2-yl]phenyl]prop-2-enoate (PubChem CID 142088150) has the molecular formula C32H31BrN2O5 and a molecular weight of 603.51 g/mol. Its IUPAC name is ethyl (E)-3-[4-[5-(4-bromophenyl)-4-[4-(2-butoxy-2-oxoethoxy)phenyl]-1H-imidazol-2-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[5-(4-bromophenyl)-4-[4-(2-butoxy-2-oxoethoxy)phenyl]-1H-imidazol-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142088150 |
| Molecular Formula | C32H31BrN2O5 |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | ethyl (E)-3-[4-[5-(4-bromophenyl)-4-[4-(2-butoxy-2-oxoethoxy)phenyl]-1H-imidazol-2-yl]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)COc1ccc(-c2nc(-c3ccc(/C=C/C(=O)OCC)cc3)[nH]c2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H31BrN2O5/c1-3-5-20-39-29(37)21-40-27-17-13-24(14-18-27)31-30(23-11-15-26(33)16-12-23)34-32(35-31)25-9-6-22(7-10-25)8-19-28(36)38-4-2/h6-19H,3-5,20-21H2,1-2H3,(H,34,35)/b19-8+ |
| InChIKey | QUGHMBNVSHCBLM-UFWORHAWSA-N |
| XLogP | 7.47 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|