About [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane
[2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane (PubChem CID 142088513) has the molecular formula C26H31FN2O6
and a molecular weight of 486.54 g/mol. Its IUPAC name is [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane.
Molecular Properties
| Compound Name | [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane |
| PubChem CID | 142088513 |
| Molecular Formula | C26H31FN2O6 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane |
| SMILES | CCC.CCCOC(=O)CC(NC(=O)COC(=O)n1c2ccccc2c2ccccc21)C(=O)CF |
| InChI | InChI=1S/C23H23FN2O6.C3H8/c1-2-11-31-22(29)12-17(20(27)13-24)25-21(28)14-32-23(30)26-18-9-5-3-7-15(18)16-8-4-6-10-19(16)26;1-3-2/h3-10,17H,2,11-14H2,1H3,(H,25,28);3H2,1-2H3 |
| InChIKey | FDSNRVQJNDURCR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane?
The IUPAC name of [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane (CID 142088513) is [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane.
What is the SMILES notation for [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane?
The canonical SMILES for [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane is CCC.CCCOC(=O)CC(NC(=O)COC(=O)n1c2ccccc2c2ccccc21)C(=O)CF.
What is the InChIKey of [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane?
The InChIKey is FDSNRVQJNDURCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O6.C3H8/c1-2-11-31-22(29)12-17(20(27)13-24)25-21(28)14-32-23(30)26-18-9-5-3-7-15(18)16-8-4-6-10-19(16)26;1-3-2/h3-10,17H,2,11-14H2,1H3,(H,25,28);3H2,1-2H3.
What are the key properties of [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane?
[2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane has a molecular weight of 486.54 g/mol, XLogP of 4.56, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-fluoro-1,4-dioxo-1-propoxypentan-3-yl)amino]-2-oxoethyl] carbazole-9-carboxylate;propane is sourced from PubChem (CID 142088513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).