About 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene
1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene (PubChem CID 142088624) has the molecular formula C16H13ClF3NO3S
and a molecular weight of 391.80 g/mol. Its IUPAC name is 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene |
| PubChem CID | 142088624 |
| Molecular Formula | C16H13ClF3NO3S |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1-c1cccc(OSCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H13ClF3NO3S/c17-14-7-2-6-13(15(14)21(22)23)11-4-1-5-12(10-11)24-25-9-3-8-16(18,19)20/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | POOKEDZOLJSPBV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene?
The IUPAC name of 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene (CID 142088624) is 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene.
What is the SMILES notation for 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene?
The canonical SMILES for 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene is O=[N+]([O-])c1c(Cl)cccc1-c1cccc(OSCCCC(F)(F)F)c1.
What is the InChIKey of 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene?
The InChIKey is POOKEDZOLJSPBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF3NO3S/c17-14-7-2-6-13(15(14)21(22)23)11-4-1-5-12(10-11)24-25-9-3-8-16(18,19)20/h1-2,4-7,10H,3,8-9H2.
What are the key properties of 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene?
1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene has a molecular weight of 391.80 g/mol, XLogP of 6.28, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-nitro-3-[3-(4,4,4-trifluorobutylsulfanyloxy)phenyl]benzene is sourced from PubChem (CID 142088624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).