C19H19N2O3S+ — CID 142089073
ethyl 8-(4-methylphenoxy)-4,5-dihydro-1H-thieno[3,4-g]indazol-1-ium-6-carboxylate (PubChem CID 142089073) has the molecular formula C19H19N2O3S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl 8-(4-methylphenoxy)-4,5-dihydro-1H-thieno[3,4-g]indazol-1-ium-6-carboxylate.
| Compound Name | ethyl 8-(4-methylphenoxy)-4,5-dihydro-1H-thieno[3,4-g]indazol-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 142089073 |
| Molecular Formula | C19H19N2O3S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | ethyl 8-(4-methylphenoxy)-4,5-dihydro-1H-thieno[3,4-g]indazol-1-ium-6-carboxylate |
| SMILES | CCOC(=O)c1sc(Oc2ccc(C)cc2)c2c1CCC1=C2[NH2+]N=C1 |
| InChI | InChI=1S/C19H18N2O3S/c1-3-23-18(22)17-14-9-6-12-10-20-21-16(12)15(14)19(25-17)24-13-7-4-11(2)5-8-13/h4-5,7-8,10H,3,6,9H2,1-2H3,(H,20,21)/p+1 |
| InChIKey | BSQOSZHPESVHLP-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|