C17H19N3OS2 — CID 14208917
2-hexylsulfanyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 14208917) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-hexylsulfanyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-hexylsulfanyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 14208917 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-hexylsulfanyl-7-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCCSc1nn2c(=O)cc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C17H19N3OS2/c1-2-3-4-8-11-22-17-19-20-15(21)12-14(18-16(20)23-17)13-9-6-5-7-10-13/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | MDZLXTFVARIENC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|