About (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one
(5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one (PubChem CID 142089328) has the molecular formula C17H13Cl2NO3S
and a molecular weight of 382.27 g/mol. Its IUPAC name is (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one |
| PubChem CID | 142089328 |
| Molecular Formula | C17H13Cl2NO3S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(O)/C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)S1 |
| InChI | InChI=1S/C17H13Cl2NO3S/c18-13-6-3-11(7-14(13)19)9-23-12-4-1-10(2-5-12)8-15-16(21)20-17(22)24-15/h1-8,16,21H,9H2,(H,20,22)/b15-8- |
| InChIKey | JYOPCKHCPFOKGF-NVNXTCNLSA-N |
| XLogP | 4.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one?
The IUPAC name of (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one (CID 142089328) is (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one.
What is the SMILES notation for (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one?
The canonical SMILES for (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one is O=C1NC(O)/C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)S1.
What is the InChIKey of (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one?
The InChIKey is JYOPCKHCPFOKGF-NVNXTCNLSA-N. The full InChI is InChI=1S/C17H13Cl2NO3S/c18-13-6-3-11(7-14(13)19)9-23-12-4-1-10(2-5-12)8-15-16(21)20-17(22)24-15/h1-8,16,21H,9H2,(H,20,22)/b15-8-.
What are the key properties of (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one?
(5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one has a molecular weight of 382.27 g/mol, XLogP of 4.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-hydroxy-1,3-thiazolidin-2-one is sourced from PubChem (CID 142089328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).