About [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate
[2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate (PubChem CID 142089386) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate.
Molecular Properties
| Compound Name | [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate |
| PubChem CID | 142089386 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate |
| SMILES | CC(Cc1ccccc1OC#N)=C1C=CC=CC1 |
| InChI | InChI=1S/C16H15NO/c1-13(14-7-3-2-4-8-14)11-15-9-5-6-10-16(15)18-12-17/h2-7,9-10H,8,11H2,1H3 |
| InChIKey | IYHRYTAPNXBOOO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate?
The IUPAC name of [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate (CID 142089386) is [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate.
What is the SMILES notation for [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate?
The canonical SMILES for [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate is CC(Cc1ccccc1OC#N)=C1C=CC=CC1.
What is the InChIKey of [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate?
The InChIKey is IYHRYTAPNXBOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-13(14-7-3-2-4-8-14)11-15-9-5-6-10-16(15)18-12-17/h2-7,9-10H,8,11H2,1H3.
What are the key properties of [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate?
[2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate has a molecular weight of 237.30 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenyl] cyanate is sourced from PubChem (CID 142089386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).