C24H42O4 — CID 142089498
(7R,13S)-3-ethoxy-5,7,10,13-tetramethyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;methanol (PubChem CID 142089498) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is (7R,13S)-3-ethoxy-5,7,10,13-tetramethyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;methanol.
| Compound Name | (7R,13S)-3-ethoxy-5,7,10,13-tetramethyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;methanol |
|---|---|
| PubChem CID | 142089498 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (7R,13S)-3-ethoxy-5,7,10,13-tetramethyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;methanol |
| SMILES | CCOC1(O)CCC2(C)C3=CC[C@]4(C)C(O)CCC4C3[C@H](C)CC2(C)C1.CO |
| InChI | InChI=1S/C23H38O3.CH4O/c1-6-26-23(25)12-11-22(5)17-9-10-21(4)16(7-8-18(21)24)19(17)15(2)13-20(22,3)14-23;1-2/h9,15-16,18-19,24-25H,6-8,10-14H2,1-5H3;2H,1H3/t15-,16?,18?,19?,20?,21+,22?,23?;/m1./s1 |
| InChIKey | OBHIPBYWHKCFOE-GMBUYOFUSA-N |
| XLogP | 4.28 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|