C19H20N2O2 — CID 142090181
(2E)-2-[(E)-1-[[(6E)-2-amino-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]methylideneamino]prop-1-enyl]penta-2,4-dienoic acid (PubChem CID 142090181) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2E)-2-[(E)-1-[[(6E)-2-amino-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]methylideneamino]prop-1-enyl]penta-2,4-dienoic acid.
| Compound Name | (2E)-2-[(E)-1-[[(6E)-2-amino-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]methylideneamino]prop-1-enyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142090181 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2E)-2-[(E)-1-[[(6E)-2-amino-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]methylideneamino]prop-1-enyl]penta-2,4-dienoic acid |
| SMILES | C=C/C=c1/c(/C=N/C(=C/C)/C(=C\C=C)C(=O)O)c(N)ccc1=C |
| InChI | InChI=1S/C19H20N2O2/c1-5-8-14-13(4)10-11-17(20)16(14)12-21-18(7-3)15(9-6-2)19(22)23/h5-12H,1-2,4,20H2,3H3,(H,22,23)/b14-8+,15-9+,18-7+,21-12+ |
| InChIKey | LIGGDSPTOWJHKE-HVOMTUEDSA-N |
| XLogP | 2.17 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|