C39H58N2O8 — CID 142091022
tert-butyl formate;methyl 1-[(2S)-2-cyclohexyl-2-[[2-(3-hydroxyphenyl)acetyl]amino]acetyl]pyrrolidine-2-carboxylate;pentoxymethylbenzene (PubChem CID 142091022) has the molecular formula C39H58N2O8 and a molecular weight of 682.90 g/mol. Its IUPAC name is tert-butyl formate;methyl 1-[(2S)-2-cyclohexyl-2-[[2-(3-hydroxyphenyl)acetyl]amino]acetyl]pyrrolidine-2-carboxylate;pentoxymethylbenzene.
| Compound Name | tert-butyl formate;methyl 1-[(2S)-2-cyclohexyl-2-[[2-(3-hydroxyphenyl)acetyl]amino]acetyl]pyrrolidine-2-carboxylate;pentoxymethylbenzene |
|---|---|
| PubChem CID | 142091022 |
| Molecular Formula | C39H58N2O8 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.42 |
| IUPAC Name | tert-butyl formate;methyl 1-[(2S)-2-cyclohexyl-2-[[2-(3-hydroxyphenyl)acetyl]amino]acetyl]pyrrolidine-2-carboxylate;pentoxymethylbenzene |
| SMILES | CC(C)(C)OC=O.CCCCCOCc1ccccc1.COC(=O)C1CCCN1C(=O)[C@@H](NC(=O)Cc1cccc(O)c1)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O5.C12H18O.C5H10O2/c1-29-22(28)18-11-6-12-24(18)21(27)20(16-8-3-2-4-9-16)23-19(26)14-15-7-5-10-17(25)13-15;1-2-3-7-10-13-11-12-8-5-4-6-9-12;1-5(2,3)7-4-6/h5,7,10,13,16,18,20,25H,2-4,6,8-9,11-12,14H2,1H3,(H,23,26);4-6,8-9H,2-3,7,10-11H2,1H3;4H,1-3H3/t18?,20-;;/m0../s1 |
| InChIKey | DPYKVUTYCITXBM-FEFQNAGISA-N |
| XLogP | 6.52 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|