C14H22O2 — CID 142091114
5-(3-ethylphenyl)hexane-1,1-diol (PubChem CID 142091114) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-(3-ethylphenyl)hexane-1,1-diol.
| Compound Name | 5-(3-ethylphenyl)hexane-1,1-diol |
|---|---|
| PubChem CID | 142091114 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 5-(3-ethylphenyl)hexane-1,1-diol |
| SMILES | CCc1cccc(C(C)CCCC(O)O)c1 |
| InChI | InChI=1S/C14H22O2/c1-3-12-7-5-8-13(10-12)11(2)6-4-9-14(15)16/h5,7-8,10-11,14-16H,3-4,6,9H2,1-2H3 |
| InChIKey | WXUYEMSLVMHPBT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|