C19H30FN2S+ — CID 142091422
ethane;[6-methyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium-1-yl] thiohypofluorite (PubChem CID 142091422) has the molecular formula C19H30FN2S+ and a molecular weight of 337.53 g/mol. Its IUPAC name is ethane;[6-methyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium-1-yl] thiohypofluorite.
| Compound Name | ethane;[6-methyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 142091422 |
| Molecular Formula | C19H30FN2S+ |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | ethane;[6-methyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium-1-yl] thiohypofluorite |
| SMILES | C=C/C=C\C(=C/C=C)C1C(C)Cc2n(SF)cc[n+]21.CC.CC |
| InChI | InChI=1S/C15H18FN2S.2C2H6/c1-4-6-8-13(7-5-2)15-12(3)11-14-17(15)9-10-18(14)19-16;2*1-2/h4-10,12,15H,1-2,11H2,3H3;2*1-2H3/q+1;;/b8-6-,13-7+;; |
| InChIKey | ONDKXSJRLJJCCK-MKWZZQCTSA-N |
| XLogP | 5.80 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|