About (2S)-2-ethyloxolane-3-thiol;methanol
(2S)-2-ethyloxolane-3-thiol;methanol (PubChem CID 142092123) has the molecular formula C7H16O2S
and a molecular weight of 164.27 g/mol. Its IUPAC name is (2S)-2-ethyloxolane-3-thiol;methanol.
Molecular Properties
| Compound Name | (2S)-2-ethyloxolane-3-thiol;methanol |
| PubChem CID | 142092123 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (2S)-2-ethyloxolane-3-thiol;methanol |
| SMILES | CC[C@@H]1OCCC1S.CO |
| InChI | InChI=1S/C6H12OS.CH4O/c1-2-5-6(8)3-4-7-5;1-2/h5-6,8H,2-4H2,1H3;2H,1H3/t5-,6?;/m0./s1 |
| InChIKey | NTKRCMQWHPPBQY-GNVLWMSISA-N |
| XLogP | 1.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-ethyloxolane-3-thiol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethyloxolane-3-thiol;methanol?
The IUPAC name of (2S)-2-ethyloxolane-3-thiol;methanol (CID 142092123) is (2S)-2-ethyloxolane-3-thiol;methanol.
What is the SMILES notation for (2S)-2-ethyloxolane-3-thiol;methanol?
The canonical SMILES for (2S)-2-ethyloxolane-3-thiol;methanol is CC[C@@H]1OCCC1S.CO.
What is the InChIKey of (2S)-2-ethyloxolane-3-thiol;methanol?
The InChIKey is NTKRCMQWHPPBQY-GNVLWMSISA-N. The full InChI is InChI=1S/C6H12OS.CH4O/c1-2-5-6(8)3-4-7-5;1-2/h5-6,8H,2-4H2,1H3;2H,1H3/t5-,6?;/m0./s1.
What are the key properties of (2S)-2-ethyloxolane-3-thiol;methanol?
(2S)-2-ethyloxolane-3-thiol;methanol has a molecular weight of 164.27 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethyloxolane-3-thiol;methanol is sourced from PubChem (CID 142092123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).