About 2-chloro-3,5-dimethylthiophene;ethane
2-chloro-3,5-dimethylthiophene;ethane (PubChem CID 142092125) has the molecular formula C10H19ClS
and a molecular weight of 206.78 g/mol. Its IUPAC name is 2-chloro-3,5-dimethylthiophene;ethane.
Molecular Properties
| Compound Name | 2-chloro-3,5-dimethylthiophene;ethane |
| PubChem CID | 142092125 |
| Molecular Formula | C10H19ClS |
| Molecular Weight | 206.78 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-chloro-3,5-dimethylthiophene;ethane |
| SMILES | CC.CC.Cc1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C6H7ClS.2C2H6/c1-4-3-5(2)8-6(4)7;2*1-2/h3H,1-2H3;2*1-2H3 |
| InChIKey | UVLHSRPYCGMPKL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.78 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-3,5-dimethylthiophene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,5-dimethylthiophene;ethane?
The IUPAC name of 2-chloro-3,5-dimethylthiophene;ethane (CID 142092125) is 2-chloro-3,5-dimethylthiophene;ethane.
What is the SMILES notation for 2-chloro-3,5-dimethylthiophene;ethane?
The canonical SMILES for 2-chloro-3,5-dimethylthiophene;ethane is CC.CC.Cc1cc(C)c(Cl)s1.
What is the InChIKey of 2-chloro-3,5-dimethylthiophene;ethane?
The InChIKey is UVLHSRPYCGMPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClS.2C2H6/c1-4-3-5(2)8-6(4)7;2*1-2/h3H,1-2H3;2*1-2H3.
What are the key properties of 2-chloro-3,5-dimethylthiophene;ethane?
2-chloro-3,5-dimethylthiophene;ethane has a molecular weight of 206.78 g/mol, XLogP of 5.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,5-dimethylthiophene;ethane is sourced from PubChem (CID 142092125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).