C19H33NS — CID 142092269
(Z)-1-cyclohexa-1,5-dien-1-yl-2-[(Z,2E)-2-ethylidenepent-3-enyl]sulfanylethenamine;ethane (PubChem CID 142092269) has the molecular formula C19H33NS and a molecular weight of 307.55 g/mol. Its IUPAC name is (Z)-1-cyclohexa-1,5-dien-1-yl-2-[(Z,2E)-2-ethylidenepent-3-enyl]sulfanylethenamine;ethane.
| Compound Name | (Z)-1-cyclohexa-1,5-dien-1-yl-2-[(Z,2E)-2-ethylidenepent-3-enyl]sulfanylethenamine;ethane |
|---|---|
| PubChem CID | 142092269 |
| Molecular Formula | C19H33NS |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (Z)-1-cyclohexa-1,5-dien-1-yl-2-[(Z,2E)-2-ethylidenepent-3-enyl]sulfanylethenamine;ethane |
| SMILES | C/C=C\C(=C/C)CS/C=C(\N)C1=CCCC=C1.CC.CC |
| InChI | InChI=1S/C15H21NS.2C2H6/c1-3-8-13(4-2)11-17-12-15(16)14-9-6-5-7-10-14;2*1-2/h3-4,6,8-10,12H,5,7,11,16H2,1-2H3;2*1-2H3/b8-3-,13-4+,15-12-;; |
| InChIKey | IEXQPTAIQBHEAE-TVKWLGKSSA-N |
| XLogP | 6.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|