About 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine
10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine (PubChem CID 142093024) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine.
Molecular Properties
| Compound Name | 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine |
| PubChem CID | 142093024 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine |
| SMILES | CC1=CC=C(N2c3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C19H17NO/c1-14-10-12-15(13-11-14)20-16-6-2-4-8-18(16)21-19-9-5-3-7-17(19)20/h2-10,12H,11,13H2,1H3 |
| InChIKey | MJVHSTDCVLDCTR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine?
The IUPAC name of 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine (CID 142093024) is 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine.
What is the SMILES notation for 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine?
The canonical SMILES for 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine is CC1=CC=C(N2c3ccccc3Oc3ccccc32)CC1.
What is the InChIKey of 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine?
The InChIKey is MJVHSTDCVLDCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO/c1-14-10-12-15(13-11-14)20-16-6-2-4-8-18(16)21-19-9-5-3-7-17(19)20/h2-10,12H,11,13H2,1H3.
What are the key properties of 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine?
10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine has a molecular weight of 275.35 g/mol, XLogP of 5.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-methylcyclohexa-1,3-dien-1-yl)phenoxazine is sourced from PubChem (CID 142093024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).