C20H31ClN2O2 — CID 142093057
2-chloro-4,6-dimethylpyridine;ethane;3-propan-2-ylpyridine-2-carboxylic acid (PubChem CID 142093057) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is 2-chloro-4,6-dimethylpyridine;ethane;3-propan-2-ylpyridine-2-carboxylic acid.
| Compound Name | 2-chloro-4,6-dimethylpyridine;ethane;3-propan-2-ylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 142093057 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-chloro-4,6-dimethylpyridine;ethane;3-propan-2-ylpyridine-2-carboxylic acid |
| SMILES | CC.CC.CC(C)c1cccnc1C(=O)O.Cc1cc(C)nc(Cl)c1 |
| InChI | InChI=1S/C9H11NO2.C7H8ClN.2C2H6/c1-6(2)7-4-3-5-10-8(7)9(11)12;1-5-3-6(2)9-7(8)4-5;2*1-2/h3-6H,1-2H3,(H,11,12);3-4H,1-2H3;2*1-2H3 |
| InChIKey | VRIZAVYFJZMIDO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|