C15H17N3O2S — CID 142093099
1-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethanone;(4E)-4-ethylidene-1H-pyrazole-5-thione (PubChem CID 142093099) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethanone;(4E)-4-ethylidene-1H-pyrazole-5-thione.
| Compound Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethanone;(4E)-4-ethylidene-1H-pyrazole-5-thione |
|---|---|
| PubChem CID | 142093099 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethanone;(4E)-4-ethylidene-1H-pyrazole-5-thione |
| SMILES | C/C=C1\C=NNC1=S.CC(=O)c1cccc2c1OCCN2 |
| InChI | InChI=1S/C10H11NO2.C5H6N2S/c1-7(12)8-3-2-4-9-10(8)13-6-5-11-9;1-2-4-3-6-7-5(4)8/h2-4,11H,5-6H2,1H3;2-3H,1H3,(H,7,8)/b;4-2+ |
| InChIKey | IDTCXFFPBYAMSQ-QGLCECKVSA-N |
| XLogP | 2.54 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_H(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|