C12H21NO — CID 142093862
(3Z,6S,9S)-9-amino-6-methyl-5-methylidenedeca-1,3-dien-2-ol (PubChem CID 142093862) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3Z,6S,9S)-9-amino-6-methyl-5-methylidenedeca-1,3-dien-2-ol.
| Compound Name | (3Z,6S,9S)-9-amino-6-methyl-5-methylidenedeca-1,3-dien-2-ol |
|---|---|
| PubChem CID | 142093862 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3Z,6S,9S)-9-amino-6-methyl-5-methylidenedeca-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)[C@@H](C)CC[C@H](C)N |
| InChI | InChI=1S/C12H21NO/c1-9(5-7-11(3)13)10(2)6-8-12(4)14/h6,8-9,11,14H,2,4-5,7,13H2,1,3H3/b8-6-/t9-,11-/m0/s1 |
| InChIKey | ZVDVDYZFLJVPTE-RJOLATDVSA-N |
| XLogP | 2.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|