About ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine
ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine (PubChem CID 142094444) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine |
| PubChem CID | 142094444 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine |
| SMILES | CC.Cc1cc(C2C=CN=CC2)cs1 |
| InChI | InChI=1S/C10H11NS.C2H6/c1-8-6-10(7-12-8)9-2-4-11-5-3-9;1-2/h2,4-7,9H,3H2,1H3;1-2H3 |
| InChIKey | FLZHZBJZBAZVPJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine?
The IUPAC name of ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine (CID 142094444) is ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine.
What is the SMILES notation for ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine?
The canonical SMILES for ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine is CC.Cc1cc(C2C=CN=CC2)cs1.
What is the InChIKey of ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine?
The InChIKey is FLZHZBJZBAZVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS.C2H6/c1-8-6-10(7-12-8)9-2-4-11-5-3-9;1-2/h2,4-7,9H,3H2,1H3;1-2H3.
What are the key properties of ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine?
ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine has a molecular weight of 207.34 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(5-methylthiophen-3-yl)-3,4-dihydropyridine is sourced from PubChem (CID 142094444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).