C22H22BN3O5S — CID 142094900
2-[[4-[3-(borinin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylamino]acetic acid;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 142094900) has the molecular formula C22H22BN3O5S and a molecular weight of 451.31 g/mol. Its IUPAC name is 2-[[4-[3-(borinin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylamino]acetic acid;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | 2-[[4-[3-(borinin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylamino]acetic acid;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142094900 |
| Molecular Formula | C22H22BN3O5S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[[4-[3-(borinin-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonylamino]acetic acid;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.O=C(O)CNS(=O)(=O)c1ccc(-c2nc(-c3ccbcc3)no2)cc1 |
| InChI | InChI=1S/C15H12BN3O5S.C7H10/c20-13(21)9-17-25(22,23)12-3-1-11(2-4-12)15-18-14(19-24-15)10-5-7-16-8-6-10;1-4-6-7(3)5-2/h1-8,17H,9H2,(H,20,21);4-6H,1-2H2,3H3/b;7-6- |
| InChIKey | XEJPRABYFUAOOF-VDXOJYAPSA-N |
| XLogP | 3.41 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|