About ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine
ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 142094930) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine |
| PubChem CID | 142094930 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=CC1=CC(C)C(C)C=C1N=C.CC.CC |
| InChI | InChI=1S/C11H15N.2C2H6/c1-5-10-6-8(2)9(3)7-11(10)12-4;2*1-2/h5-9H,1,4H2,2-3H3;2*1-2H3 |
| InChIKey | WFUFHRILMVYBQR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine?
The IUPAC name of ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine (CID 142094930) is ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine.
What is the SMILES notation for ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine?
The canonical SMILES for ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine is C=CC1=CC(C)C(C)C=C1N=C.CC.CC.
What is the InChIKey of ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine?
The InChIKey is WFUFHRILMVYBQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.2C2H6/c1-5-10-6-8(2)9(3)7-11(10)12-4;2*1-2/h5-9H,1,4H2,2-3H3;2*1-2H3.
What are the key properties of ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine?
ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine has a molecular weight of 221.39 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(6-ethenyl-3,4-dimethylcyclohexa-1,5-dien-1-yl)methanimine is sourced from PubChem (CID 142094930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).