C18H24N2 — CID 142095216
2-N-[(3,4-dimethylcyclohexa-1,3-dien-1-yl)methyl]-2,3-dihydro-1H-indene-2,5-diamine (PubChem CID 142095216) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-N-[(3,4-dimethylcyclohexa-1,3-dien-1-yl)methyl]-2,3-dihydro-1H-indene-2,5-diamine.
| Compound Name | 2-N-[(3,4-dimethylcyclohexa-1,3-dien-1-yl)methyl]-2,3-dihydro-1H-indene-2,5-diamine |
|---|---|
| PubChem CID | 142095216 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-N-[(3,4-dimethylcyclohexa-1,3-dien-1-yl)methyl]-2,3-dihydro-1H-indene-2,5-diamine |
| SMILES | CC1=C(C)CCC(CNC2Cc3ccc(N)cc3C2)=C1 |
| InChI | InChI=1S/C18H24N2/c1-12-3-4-14(7-13(12)2)11-20-18-9-15-5-6-17(19)8-16(15)10-18/h5-8,18,20H,3-4,9-11,19H2,1-2H3 |
| InChIKey | WSYYMTXZIRMCCF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|