C22H39NO4 — CID 142095332
(Z,3S,8R)-15-(dimethylamino)-3-hydroxy-4,4,6,8,12-pentamethyl-5,9-dioxopentadec-12-enal (PubChem CID 142095332) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is (Z,3S,8R)-15-(dimethylamino)-3-hydroxy-4,4,6,8,12-pentamethyl-5,9-dioxopentadec-12-enal.
| Compound Name | (Z,3S,8R)-15-(dimethylamino)-3-hydroxy-4,4,6,8,12-pentamethyl-5,9-dioxopentadec-12-enal |
|---|---|
| PubChem CID | 142095332 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (Z,3S,8R)-15-(dimethylamino)-3-hydroxy-4,4,6,8,12-pentamethyl-5,9-dioxopentadec-12-enal |
| SMILES | C/C(=C/CCN(C)C)CCC(=O)[C@H](C)CC(C)C(=O)C(C)(C)[C@@H](O)CC=O |
| InChI | InChI=1S/C22H39NO4/c1-16(9-8-13-23(6)7)10-11-19(25)17(2)15-18(3)21(27)22(4,5)20(26)12-14-24/h9,14,17-18,20,26H,8,10-13,15H2,1-7H3/b16-9-/t17-,18?,20+/m1/s1 |
| InChIKey | XQUROFLBNAPBAY-SIRPVPRCSA-N |
| XLogP | 3.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|