C19H31NO4 — CID 142095362
(4S,13Z)-4-hydroxy-5,7,9,13-tetramethyl-1-azacyclohexadec-13-ene-2,6,10-trione (PubChem CID 142095362) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is (4S,13Z)-4-hydroxy-5,7,9,13-tetramethyl-1-azacyclohexadec-13-ene-2,6,10-trione.
| Compound Name | (4S,13Z)-4-hydroxy-5,7,9,13-tetramethyl-1-azacyclohexadec-13-ene-2,6,10-trione |
|---|---|
| PubChem CID | 142095362 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (4S,13Z)-4-hydroxy-5,7,9,13-tetramethyl-1-azacyclohexadec-13-ene-2,6,10-trione |
| SMILES | C/C1=C/CCNC(=O)C[C@H](O)C(C)C(=O)C(C)CC(C)C(=O)CC1 |
| InChI | InChI=1S/C19H31NO4/c1-12-6-5-9-20-18(23)11-17(22)15(4)19(24)14(3)10-13(2)16(21)8-7-12/h6,13-15,17,22H,5,7-11H2,1-4H3,(H,20,23)/b12-6-/t13?,14?,15?,17-/m0/s1 |
| InChIKey | JWNAPOWEFPNYTM-DKSPKQRJSA-N |
| XLogP | 2.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|