C8H11ClN5O3S+ — CID 142095655
(NE)-N-[3-[(2-chloro-1,3-thiazol-3-ium-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 142095655) has the molecular formula C8H11ClN5O3S+ and a molecular weight of 292.73 g/mol. Its IUPAC name is (NE)-N-[3-[(2-chloro-1,3-thiazol-3-ium-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | (NE)-N-[3-[(2-chloro-1,3-thiazol-3-ium-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 142095655 |
| Molecular Formula | C8H11ClN5O3S+ |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (NE)-N-[3-[(2-chloro-1,3-thiazol-3-ium-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CN1COCN(Cc2c[nH+]c(Cl)s2)/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3/p+1/b11-8+ |
| InChIKey | NWWZPOKUUAIXIW-DHZHZOJOSA-O |
| XLogP | 0.44 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|