About [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite
[4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite (PubChem CID 142095702) has the molecular formula C14H12FN3OS
and a molecular weight of 289.34 g/mol. Its IUPAC name is [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite |
| PubChem CID | 142095702 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite |
| SMILES | Cc1ncc(SF)c(Oc2c(C)cc(C#N)cc2C)n1 |
| InChI | InChI=1S/C14H12FN3OS/c1-8-4-11(6-16)5-9(2)13(8)19-14-12(20-15)7-17-10(3)18-14/h4-5,7H,1-3H3 |
| InChIKey | ZSORZPQQRGARNL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite?
The IUPAC name of [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite (CID 142095702) is [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite.
What is the SMILES notation for [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite?
The canonical SMILES for [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite is Cc1ncc(SF)c(Oc2c(C)cc(C#N)cc2C)n1.
What is the InChIKey of [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite?
The InChIKey is ZSORZPQQRGARNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3OS/c1-8-4-11(6-16)5-9(2)13(8)19-14-12(20-15)7-17-10(3)18-14/h4-5,7H,1-3H3.
What are the key properties of [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite?
[4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite has a molecular weight of 289.34 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-cyano-2,6-dimethylphenoxy)-2-methylpyrimidin-5-yl] thiohypofluorite is sourced from PubChem (CID 142095702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).