C32H43N5O4 — CID 142095834
formamide;1-(2-methyl-3,3-diphenylpropanoyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)azetidine-2-carboxamide;2-methylpropan-2-ol (PubChem CID 142095834) has the molecular formula C32H43N5O4 and a molecular weight of 561.73 g/mol. Its IUPAC name is formamide;1-(2-methyl-3,3-diphenylpropanoyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)azetidine-2-carboxamide;2-methylpropan-2-ol.
| Compound Name | formamide;1-(2-methyl-3,3-diphenylpropanoyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)azetidine-2-carboxamide;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 142095834 |
| Molecular Formula | C32H43N5O4 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | formamide;1-(2-methyl-3,3-diphenylpropanoyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)azetidine-2-carboxamide;2-methylpropan-2-ol |
| SMILES | CC(C(=O)N1CCC1C(=O)NC1CCc2[nH]ncc2C1)C(c1ccccc1)c1ccccc1.CC(C)(C)O.NC=O |
| InChI | InChI=1S/C27H30N4O2.C4H10O.CH3NO/c1-18(25(19-8-4-2-5-9-19)20-10-6-3-7-11-20)27(33)31-15-14-24(31)26(32)29-22-12-13-23-21(16-22)17-28-30-23;1-4(2,3)5;2-1-3/h2-11,17-18,22,24-25H,12-16H2,1H3,(H,28,30)(H,29,32);5H,1-3H3;1H,(H2,2,3) |
| InChIKey | LPARKROSJZLZCF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|