C14H22FNO — CID 142095990
[(3S,4S)-4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-methylpiperidin-3-yl]methanol (PubChem CID 142095990) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is [(3S,4S)-4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-methylpiperidin-3-yl]methanol.
| Compound Name | [(3S,4S)-4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-methylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 142095990 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | [(3S,4S)-4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]-1-methylpiperidin-3-yl]methanol |
| SMILES | C/C=C\C(F)=C/C=C/[C@@H]1CCN(C)C[C@H]1CO |
| InChI | InChI=1S/C14H22FNO/c1-3-5-14(15)7-4-6-12-8-9-16(2)10-13(12)11-17/h3-7,12-13,17H,8-11H2,1-2H3/b5-3-,6-4+,14-7+/t12-,13+/m1/s1 |
| InChIKey | JGDCTMPDDXPTOJ-QIRIHVMRSA-N |
| XLogP | 2.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|