C26H27NO5S — CID 142096123
N-(oxan-2-yloxy)-3-[(4-phenylphenyl)methylsulfonyl]cyclohepta-2,4,6-triene-1-carboxamide (PubChem CID 142096123) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-3-[(4-phenylphenyl)methylsulfonyl]cyclohepta-2,4,6-triene-1-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-3-[(4-phenylphenyl)methylsulfonyl]cyclohepta-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 142096123 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-(oxan-2-yloxy)-3-[(4-phenylphenyl)methylsulfonyl]cyclohepta-2,4,6-triene-1-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1C=CC=CC(S(=O)(=O)Cc2ccc(-c3ccccc3)cc2)=C1 |
| InChI | InChI=1S/C26H27NO5S/c28-26(27-32-25-12-6-7-17-31-25)23-10-4-5-11-24(18-23)33(29,30)19-20-13-15-22(16-14-20)21-8-2-1-3-9-21/h1-5,8-11,13-16,18,23,25H,6-7,12,17,19H2,(H,27,28) |
| InChIKey | CFKOONJWCNSZOC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|