C24H31N3O3 — CID 142096417
N-[2-[ethyl(propan-2-yl)amino]ethyl]-2-formyl-6-phenoxy-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 142096417) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[2-[ethyl(propan-2-yl)amino]ethyl]-2-formyl-6-phenoxy-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | N-[2-[ethyl(propan-2-yl)amino]ethyl]-2-formyl-6-phenoxy-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 142096417 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[2-[ethyl(propan-2-yl)amino]ethyl]-2-formyl-6-phenoxy-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCN(CCNC(=O)C1c2ccc(Oc3ccccc3)cc2CCN1C=O)C(C)C |
| InChI | InChI=1S/C24H31N3O3/c1-4-26(18(2)3)15-13-25-24(29)23-22-11-10-21(30-20-8-6-5-7-9-20)16-19(22)12-14-27(23)17-28/h5-11,16-18,23H,4,12-15H2,1-3H3,(H,25,29) |
| InChIKey | QQTZLYDRADEOER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|