About (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]
(2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] (PubChem CID 142096761) has the molecular formula C11H11FO
and a molecular weight of 178.21 g/mol. Its IUPAC name is (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane].
Molecular Properties
| Compound Name | (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| PubChem CID | 142096761 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| SMILES | C[C@@H]1CC12COc1cc(F)ccc12 |
| InChI | InChI=1S/C11H11FO/c1-7-5-11(7)6-13-10-4-8(12)2-3-9(10)11/h2-4,7H,5-6H2,1H3/t7-,11?/m1/s1 |
| InChIKey | ZFNIZBFRRLLELR-DKSCNQEISA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The IUPAC name of (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] (CID 142096761) is (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane].
What is the SMILES notation for (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The canonical SMILES for (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] is C[C@@H]1CC12COc1cc(F)ccc12.
What is the InChIKey of (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The InChIKey is ZFNIZBFRRLLELR-DKSCNQEISA-N. The full InChI is InChI=1S/C11H11FO/c1-7-5-11(7)6-13-10-4-8(12)2-3-9(10)11/h2-4,7H,5-6H2,1H3/t7-,11?/m1/s1.
What are the key properties of (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
(2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] has a molecular weight of 178.21 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R)-6-fluoro-2'-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] is sourced from PubChem (CID 142096761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).