C22H32N2O3 — CID 142096956
1-(1,2,3,4,5,6-hexahydro-3-benzazocin-9-yl)-4-[4-(2-hydroxyethyl)piperidin-1-yl]butane-1,4-dione (PubChem CID 142096956) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6-hexahydro-3-benzazocin-9-yl)-4-[4-(2-hydroxyethyl)piperidin-1-yl]butane-1,4-dione.
| Compound Name | 1-(1,2,3,4,5,6-hexahydro-3-benzazocin-9-yl)-4-[4-(2-hydroxyethyl)piperidin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 142096956 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-(1,2,3,4,5,6-hexahydro-3-benzazocin-9-yl)-4-[4-(2-hydroxyethyl)piperidin-1-yl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCC(CCO)CC1)c1ccc2c(c1)CCNCCC2 |
| InChI | InChI=1S/C22H32N2O3/c25-15-10-17-8-13-24(14-9-17)22(27)6-5-21(26)20-4-3-18-2-1-11-23-12-7-19(18)16-20/h3-4,16-17,23,25H,1-2,5-15H2 |
| InChIKey | YVXYMXLQFPKGIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |