About 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone
2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 142097066) has the molecular formula C18H9F6NOS
and a molecular weight of 401.33 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone |
| PubChem CID | 142097066 |
| Molecular Formula | C18H9F6NOS |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)C(F)c1nc(-c2c(F)cccc2F)cs1 |
| InChI | InChI=1S/C18H9F6NOS/c19-11-6-3-7-12(20)14(11)13-8-27-17(25-13)15(21)16(26)9-4-1-2-5-10(9)18(22,23)24/h1-8,15H |
| InChIKey | RXPBGLAKFNFYRS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone?
The IUPAC name of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone (CID 142097066) is 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone.
What is the SMILES notation for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone?
The canonical SMILES for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone is O=C(c1ccccc1C(F)(F)F)C(F)c1nc(-c2c(F)cccc2F)cs1.
What is the InChIKey of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone?
The InChIKey is RXPBGLAKFNFYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F6NOS/c19-11-6-3-7-12(20)14(11)13-8-27-17(25-13)15(21)16(26)9-4-1-2-5-10(9)18(22,23)24/h1-8,15H.
What are the key properties of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone?
2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone has a molecular weight of 401.33 g/mol, XLogP of 6.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethanone is sourced from PubChem (CID 142097066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).