About 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane
2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane (PubChem CID 142097069) has the molecular formula C20H16F5NOS
and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane.
Molecular Properties
| Compound Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane |
| PubChem CID | 142097069 |
| Molecular Formula | C20H16F5NOS |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane |
| SMILES | CC.O=C(Cc1nc(-c2c(F)cccc2F)cs1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H10F5NOS.C2H6/c19-12-6-3-7-13(20)17(12)14-9-26-16(24-14)8-15(25)10-4-1-2-5-11(10)18(21,22)23;1-2/h1-7,9H,8H2;1-2H3 |
| InChIKey | MODCCSYXVLQVPV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane?
The IUPAC name of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane (CID 142097069) is 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane.
What is the SMILES notation for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane?
The canonical SMILES for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane is CC.O=C(Cc1nc(-c2c(F)cccc2F)cs1)c1ccccc1C(F)(F)F.
What is the InChIKey of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane?
The InChIKey is MODCCSYXVLQVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F5NOS.C2H6/c19-12-6-3-7-13(20)17(12)14-9-26-16(24-14)8-15(25)10-4-1-2-5-11(10)18(21,22)23;1-2/h1-7,9H,8H2;1-2H3.
What are the key properties of 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane?
2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane has a molecular weight of 413.41 g/mol, XLogP of 6.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-1-[2-(trifluoromethyl)phenyl]ethanone;ethane is sourced from PubChem (CID 142097069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).