About N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium
N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium (PubChem CID 142097114) has the molecular formula C12H19NOY
and a molecular weight of 282.20 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium |
| PubChem CID | 142097114 |
| Molecular Formula | C12H19NOY |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium |
| SMILES | CCOCCNC1=CCC(C)=CC=C1.[Y] |
| InChI | InChI=1S/C12H19NO.Y/c1-3-14-10-9-13-12-6-4-5-11(2)7-8-12;/h4-6,8,13H,3,7,9-10H2,1-2H3; |
| InChIKey | CHWVTYFUCBDKST-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium?
The IUPAC name of N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium (CID 142097114) is N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium.
What is the SMILES notation for N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium?
The canonical SMILES for N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium is CCOCCNC1=CCC(C)=CC=C1.[Y].
What is the InChIKey of N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium?
The InChIKey is CHWVTYFUCBDKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.Y/c1-3-14-10-9-13-12-6-4-5-11(2)7-8-12;/h4-6,8,13H,3,7,9-10H2,1-2H3;.
What are the key properties of N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium?
N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium has a molecular weight of 282.20 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-4-methylcyclohepta-1,4,6-trien-1-amine;yttrium is sourced from PubChem (CID 142097114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).