C13H21NO — CID 142097117
N-(2-ethoxyethyl)-N,4-dimethylcyclohepta-1,4,6-trien-1-amine (PubChem CID 142097117) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N,4-dimethylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-(2-ethoxyethyl)-N,4-dimethylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142097117 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-(2-ethoxyethyl)-N,4-dimethylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CCOCCN(C)C1=CCC(C)=CC=C1 |
| InChI | InChI=1S/C13H21NO/c1-4-15-11-10-14(3)13-7-5-6-12(2)8-9-13/h5-7,9H,4,8,10-11H2,1-3H3 |
| InChIKey | HISARLFPRYSIRD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|