C12H14OS — CID 142097288
2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]-5-methylthiophene (PubChem CID 142097288) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]-5-methylthiophene.
| Compound Name | 2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]-5-methylthiophene |
|---|---|
| PubChem CID | 142097288 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]-5-methylthiophene |
| SMILES | C/C=C\C=C/C=C/Oc1ccc(C)s1 |
| InChI | InChI=1S/C12H14OS/c1-3-4-5-6-7-10-13-12-9-8-11(2)14-12/h3-10H,1-2H3/b4-3-,6-5-,10-7+ |
| InChIKey | QQETVARVIGYLKA-PZOXCDAASA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|