C24H31NO4 — CID 142097405
2-[2-[2-(4-hexyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethoxy]phenyl]acetic acid (PubChem CID 142097405) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[2-[2-(4-hexyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[2-(4-hexyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 142097405 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[2-[2-(4-hexyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethoxy]phenyl]acetic acid |
| SMILES | CCCCCCN1CC(CCOc2ccccc2CC(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C24H31NO4/c1-2-3-4-9-15-25-18-20(29-23-13-8-6-11-21(23)25)14-16-28-22-12-7-5-10-19(22)17-24(26)27/h5-8,10-13,20H,2-4,9,14-18H2,1H3,(H,26,27) |
| InChIKey | UATMHDOBOVDOEV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|