About 2-piperidin-1-yl-3,4-dihydropyridin-5-amine
2-piperidin-1-yl-3,4-dihydropyridin-5-amine (PubChem CID 142097609) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-piperidin-1-yl-3,4-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 2-piperidin-1-yl-3,4-dihydropyridin-5-amine |
| PubChem CID | 142097609 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-piperidin-1-yl-3,4-dihydropyridin-5-amine |
| SMILES | NC1=CN=C(N2CCCCC2)CC1 |
| InChI | InChI=1S/C10H17N3/c11-9-4-5-10(12-8-9)13-6-2-1-3-7-13/h8H,1-7,11H2 |
| InChIKey | QDSRHDXSIRGUMT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-yl-3,4-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-yl-3,4-dihydropyridin-5-amine?
The IUPAC name of 2-piperidin-1-yl-3,4-dihydropyridin-5-amine (CID 142097609) is 2-piperidin-1-yl-3,4-dihydropyridin-5-amine.
What is the SMILES notation for 2-piperidin-1-yl-3,4-dihydropyridin-5-amine?
The canonical SMILES for 2-piperidin-1-yl-3,4-dihydropyridin-5-amine is NC1=CN=C(N2CCCCC2)CC1.
What is the InChIKey of 2-piperidin-1-yl-3,4-dihydropyridin-5-amine?
The InChIKey is QDSRHDXSIRGUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c11-9-4-5-10(12-8-9)13-6-2-1-3-7-13/h8H,1-7,11H2.
What are the key properties of 2-piperidin-1-yl-3,4-dihydropyridin-5-amine?
2-piperidin-1-yl-3,4-dihydropyridin-5-amine has a molecular weight of 179.27 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-3,4-dihydropyridin-5-amine is sourced from PubChem (CID 142097609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).