About 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane
4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane (PubChem CID 142097693) has the molecular formula C12H15FO3
and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane.
Molecular Properties
| Compound Name | 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane |
| PubChem CID | 142097693 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane |
| SMILES | CC1CC1.O=Cc1ccc(OCF)c(O)c1 |
| InChI | InChI=1S/C8H7FO3.C4H8/c9-5-12-8-2-1-6(4-10)3-7(8)11;1-4-2-3-4/h1-4,11H,5H2;4H,2-3H2,1H3 |
| InChIKey | FIHBLROTOUFCNG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane?
The IUPAC name of 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane (CID 142097693) is 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane.
What is the SMILES notation for 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane?
The canonical SMILES for 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane is CC1CC1.O=Cc1ccc(OCF)c(O)c1.
What is the InChIKey of 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane?
The InChIKey is FIHBLROTOUFCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO3.C4H8/c9-5-12-8-2-1-6(4-10)3-7(8)11;1-4-2-3-4/h1-4,11H,5H2;4H,2-3H2,1H3.
What are the key properties of 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane?
4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane has a molecular weight of 226.25 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethoxy)-3-hydroxybenzaldehyde;methylcyclopropane is sourced from PubChem (CID 142097693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).